C21H30F3N — CID 139541456
(3E,5E)-3-[(3,4-dimethylcyclopenta-2,4-dien-1-yl)methyl]-N,N,2,2-tetramethyl-6-(trifluoromethyl)octa-3,5,7-trien-1-amine (PubChem CID 139541456) has the molecular formula C21H30F3N and a molecular weight of 353.47 g/mol. Its IUPAC name is (3E,5E)-3-[(3,4-dimethylcyclopenta-2,4-dien-1-yl)methyl]-N,N,2,2-tetramethyl-6-(trifluoromethyl)octa-3,5,7-trien-1-amine.
| Compound Name | (3E,5E)-3-[(3,4-dimethylcyclopenta-2,4-dien-1-yl)methyl]-N,N,2,2-tetramethyl-6-(trifluoromethyl)octa-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 139541456 |
| Molecular Formula | C21H30F3N |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | (3E,5E)-3-[(3,4-dimethylcyclopenta-2,4-dien-1-yl)methyl]-N,N,2,2-tetramethyl-6-(trifluoromethyl)octa-3,5,7-trien-1-amine |
| SMILES | C=C/C(=C\C=C(/CC1C=C(C)C(C)=C1)C(C)(C)CN(C)C)C(F)(F)F |
| InChI | InChI=1S/C21H30F3N/c1-8-18(21(22,23)24)9-10-19(20(4,5)14-25(6)7)13-17-11-15(2)16(3)12-17/h8-12,17H,1,13-14H2,2-7H3/b18-9+,19-10+ |
| InChIKey | ICFMLUIJPZIWCD-VNIJRHKQSA-N |
| XLogP | 6.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|