About (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine
(NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine (PubChem CID 139541469) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine |
| PubChem CID | 139541469 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine |
| SMILES | CC1(C)/C(=N\O)C2CCN1C2 |
| InChI | InChI=1S/C8H14N2O/c1-8(2)7(9-11)6-3-4-10(8)5-6/h6,11H,3-5H2,1-2H3/b9-7- |
| InChIKey | AESJVRIDCGTZRS-CLFYSBASSA-N |
| XLogP | 0.93 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine?
The IUPAC name of (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine (CID 139541469) is (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine.
What is the SMILES notation for (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine?
The canonical SMILES for (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine is CC1(C)/C(=N\O)C2CCN1C2.
What is the InChIKey of (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine?
The InChIKey is AESJVRIDCGTZRS-CLFYSBASSA-N. The full InChI is InChI=1S/C8H14N2O/c1-8(2)7(9-11)6-3-4-10(8)5-6/h6,11H,3-5H2,1-2H3/b9-7-.
What are the key properties of (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine?
(NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine has a molecular weight of 154.21 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(2,2-dimethyl-1-azabicyclo[2.2.1]heptan-3-ylidene)hydroxylamine is sourced from PubChem (CID 139541469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).