About [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate
[(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate (PubChem CID 139541592) has the molecular formula C11H19NS
and a molecular weight of 197.35 g/mol. Its IUPAC name is [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate.
Molecular Properties
| Compound Name | [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate |
| PubChem CID | 139541592 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate |
| SMILES | C=C(C)/N=C/SC/C=C\C(C)(C)C |
| InChI | InChI=1S/C11H19NS/c1-10(2)12-9-13-8-6-7-11(3,4)5/h6-7,9H,1,8H2,2-5H3/b7-6-,12-9+ |
| InChIKey | USEDOVPGCMXLNG-IYNHQRNQSA-N |
| XLogP | 3.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate?
The IUPAC name of [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate (CID 139541592) is [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate.
What is the SMILES notation for [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate?
The canonical SMILES for [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate is C=C(C)/N=C/SC/C=C\C(C)(C)C.
What is the InChIKey of [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate?
The InChIKey is USEDOVPGCMXLNG-IYNHQRNQSA-N. The full InChI is InChI=1S/C11H19NS/c1-10(2)12-9-13-8-6-7-11(3,4)5/h6-7,9H,1,8H2,2-5H3/b7-6-,12-9+.
What are the key properties of [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate?
[(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate has a molecular weight of 197.35 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4,4-dimethylpent-2-enyl] N-prop-1-en-2-ylmethanimidothioate is sourced from PubChem (CID 139541592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).