C12H19NO — CID 139542049
3-methyl-2,3,4,5,6,7,9,10-octahydro-1,4-benzoxazonine (PubChem CID 139542049) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-methyl-2,3,4,5,6,7,9,10-octahydro-1,4-benzoxazonine.
| Compound Name | 3-methyl-2,3,4,5,6,7,9,10-octahydro-1,4-benzoxazonine |
|---|---|
| PubChem CID | 139542049 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-methyl-2,3,4,5,6,7,9,10-octahydro-1,4-benzoxazonine |
| SMILES | CC1COC2=CCCC=C2CCCN1 |
| InChI | InChI=1S/C12H19NO/c1-10-9-14-12-7-3-2-5-11(12)6-4-8-13-10/h5,7,10,13H,2-4,6,8-9H2,1H3 |
| InChIKey | VBRHIMKNNYSDQA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |