About 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol
4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol (PubChem CID 139542094) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol.
Molecular Properties
| Compound Name | 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol |
| PubChem CID | 139542094 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol |
| SMILES | C=C(C)[C@H](N)CC1=CC=C(O)CC=C1 |
| InChI | InChI=1S/C12H17NO/c1-9(2)12(13)8-10-4-3-5-11(14)7-6-10/h3-4,6-7,12,14H,1,5,8,13H2,2H3/t12-/m1/s1 |
| InChIKey | HSWSVQXFESNYGI-GFCCVEGCSA-N |
| XLogP | 2.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol?
The IUPAC name of 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol (CID 139542094) is 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol.
What is the SMILES notation for 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol?
The canonical SMILES for 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol is C=C(C)[C@H](N)CC1=CC=C(O)CC=C1.
What is the InChIKey of 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol?
The InChIKey is HSWSVQXFESNYGI-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H17NO/c1-9(2)12(13)8-10-4-3-5-11(14)7-6-10/h3-4,6-7,12,14H,1,5,8,13H2,2H3/t12-/m1/s1.
What are the key properties of 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol?
4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol has a molecular weight of 191.27 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-2-amino-3-methylbut-3-enyl]cyclohepta-1,3,5-trien-1-ol is sourced from PubChem (CID 139542094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).