C23H38N2 — CID 139542118
1-[(Z,2E)-2-ethylidenehex-3-enyl]-1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-2-[(2E)-2-ethylpenta-2,4-dienyl]hydrazine (PubChem CID 139542118) has the molecular formula C23H38N2 and a molecular weight of 342.57 g/mol. Its IUPAC name is 1-[(Z,2E)-2-ethylidenehex-3-enyl]-1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-2-[(2E)-2-ethylpenta-2,4-dienyl]hydrazine.
| Compound Name | 1-[(Z,2E)-2-ethylidenehex-3-enyl]-1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-2-[(2E)-2-ethylpenta-2,4-dienyl]hydrazine |
|---|---|
| PubChem CID | 139542118 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | 1-[(Z,2E)-2-ethylidenehex-3-enyl]-1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-2-[(2E)-2-ethylpenta-2,4-dienyl]hydrazine |
| SMILES | C=C/C=C(\CC)CNN(CC(/C=C\CC)=C/C)CC(=C/C)/C(C)=C\C |
| InChI | InChI=1S/C23H38N2/c1-8-14-16-22(12-5)18-25(19-23(13-6)20(7)10-3)24-17-21(11-4)15-9-2/h9-10,12-16,24H,2,8,11,17-19H2,1,3-7H3/b16-14-,20-10-,21-15+,22-12+,23-13- |
| InChIKey | RBKQSIPWZXQWOS-BATNOGQASA-N |
| XLogP | 6.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|