C25H38N2O — CID 139542184
(2E,4Z)-4-[[2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]ethyl-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]amino]methyl]hepta-2,4,6-trien-3-ol (PubChem CID 139542184) has the molecular formula C25H38N2O and a molecular weight of 382.59 g/mol. Its IUPAC name is (2E,4Z)-4-[[2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]ethyl-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]amino]methyl]hepta-2,4,6-trien-3-ol.
| Compound Name | (2E,4Z)-4-[[2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]ethyl-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]amino]methyl]hepta-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 139542184 |
| Molecular Formula | C25H38N2O |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | (2E,4Z)-4-[[2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]ethyl-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]amino]methyl]hepta-2,4,6-trien-3-ol |
| SMILES | C=C/C=C(CN(CCNC/C(C=C)=C/C=C)CC(/C=C\C)=C/CC)\C(O)=C/C |
| InChI | InChI=1S/C25H38N2O/c1-7-13-22(11-5)19-26-17-18-27(20-23(14-8-2)15-9-3)21-24(16-10-4)25(28)12-6/h7-8,10-16,26,28H,1,4-5,9,17-21H2,2-3,6H3/b14-8-,22-13+,23-15+,24-16-,25-12+ |
| InChIKey | QSBZEPUBACOKSF-PKUSOHCBSA-N |
| XLogP | 5.66 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|