C30H48N2 — CID 139542186
1,2-bis[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E)-2-ethylpenta-2,4-dienyl]-2-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]hydrazine (PubChem CID 139542186) has the molecular formula C30H48N2 and a molecular weight of 436.73 g/mol. Its IUPAC name is 1,2-bis[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E)-2-ethylpenta-2,4-dienyl]-2-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]hydrazine.
| Compound Name | 1,2-bis[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E)-2-ethylpenta-2,4-dienyl]-2-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]hydrazine |
|---|---|
| PubChem CID | 139542186 |
| Molecular Formula | C30H48N2 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.38 |
| IUPAC Name | 1,2-bis[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E)-2-ethylpenta-2,4-dienyl]-2-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]hydrazine |
| SMILES | C=C/C=C(\CC)CN(CC(=C/C)/C(C)=C\C)N(CC(=C/C)/C(C)=C\C)C(=C/C)/C(C)=C\C |
| InChI | InChI=1S/C30H48N2/c1-12-20-27(16-5)21-31(22-28(17-6)24(9)13-2)32(30(19-8)26(11)15-4)23-29(18-7)25(10)14-3/h12-15,17-20H,1,16,21-23H2,2-11H3/b24-13-,25-14-,26-15-,27-20+,28-17-,29-18-,30-19+ |
| InChIKey | CYBNWYDYMVPCJY-TUFZASRMSA-N |
| XLogP | 8.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|