C21H32N2 — CID 139542195
2-[(2E)-2-ethenylpenta-2,4-dienyl]-1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E,4Z)-hexa-2,4-dien-3-yl]hydrazine (PubChem CID 139542195) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 2-[(2E)-2-ethenylpenta-2,4-dienyl]-1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E,4Z)-hexa-2,4-dien-3-yl]hydrazine.
| Compound Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]-1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E,4Z)-hexa-2,4-dien-3-yl]hydrazine |
|---|---|
| PubChem CID | 139542195 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 2-[(2E)-2-ethenylpenta-2,4-dienyl]-1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E,4Z)-hexa-2,4-dien-3-yl]hydrazine |
| SMILES | C=C/C=C(\C=C)CNN(CC(=C/C)/C(C)=C\C)C(/C=C\C)=C/C |
| InChI | InChI=1S/C21H32N2/c1-8-14-19(11-4)16-22-23(21(13-6)15-9-2)17-20(12-5)18(7)10-3/h8-15,22H,1,4,16-17H2,2-3,5-7H3/b15-9-,18-10-,19-14+,20-12-,21-13+ |
| InChIKey | SCXWFLVDVBADTQ-JOZMTTACSA-N |
| XLogP | 5.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|