C31H46N2O3 — CID 139542207
6-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]-3-methylcyclohexa-1,5-dien-1-ol (PubChem CID 139542207) has the molecular formula C31H46N2O3 and a molecular weight of 494.72 g/mol. Its IUPAC name is 6-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]-3-methylcyclohexa-1,5-dien-1-ol.
| Compound Name | 6-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]-3-methylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 139542207 |
| Molecular Formula | C31H46N2O3 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.35 |
| IUPAC Name | 6-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]-3-methylcyclohexa-1,5-dien-1-ol |
| SMILES | C=C/C(O)=C(\C=C)CN(CCN(CC1=CCC(C)C=C1O)CC(/C=C\C)=C/C)CC(=C/C)/C(O)=C\C |
| InChI | InChI=1S/C31H46N2O3/c1-8-14-25(9-2)20-32(23-28-16-15-24(7)19-31(28)36)17-18-33(21-26(10-3)29(34)12-5)22-27(11-4)30(35)13-6/h8-14,16,19,24,34-36H,3,5,15,17-18,20-23H2,1-2,4,6-7H3/b14-8-,25-9+,27-11-,29-26-,30-13+ |
| InChIKey | QNCRIUJBTRMSDN-MZTBNEJSSA-N |
| XLogP | 7.11 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|