C31H48N2O — CID 139542209
(2E,4Z)-4-[[2-[[(2E)-2-ethenylpenta-2,4-dienyl]-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]hexa-2,4-dien-3-ol (PubChem CID 139542209) has the molecular formula C31H48N2O and a molecular weight of 464.74 g/mol. Its IUPAC name is (2E,4Z)-4-[[2-[[(2E)-2-ethenylpenta-2,4-dienyl]-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]hexa-2,4-dien-3-ol.
| Compound Name | (2E,4Z)-4-[[2-[[(2E)-2-ethenylpenta-2,4-dienyl]-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]hexa-2,4-dien-3-ol |
|---|---|
| PubChem CID | 139542209 |
| Molecular Formula | C31H48N2O |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.38 |
| IUPAC Name | (2E,4Z)-4-[[2-[[(2E)-2-ethenylpenta-2,4-dienyl]-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]hexa-2,4-dien-3-ol |
| SMILES | C=C/C=C(\C=C)CN(CCN(CC(=C/C)/C(O)=C\C)CC(/C=C\C)=C/C)CC(=C/C)/C(C)=C\C |
| InChI | InChI=1S/C31H48N2O/c1-10-18-27(13-4)22-32(24-29(15-6)26(9)12-3)20-21-33(23-28(14-5)19-11-2)25-30(16-7)31(34)17-8/h10-19,34H,1,4,20-25H2,2-3,5-9H3/b19-11-,26-12-,27-18+,28-14+,29-15-,30-16-,31-17+ |
| InChIKey | CCCVYSWYTVDGFS-PMFXETSXSA-N |
| XLogP | 7.73 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|