C22H38N2 — CID 139542240
1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E)-2-ethylidenepentyl]-2-[(2E)-2-ethylpenta-2,4-dienyl]hydrazine (PubChem CID 139542240) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is 1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E)-2-ethylidenepentyl]-2-[(2E)-2-ethylpenta-2,4-dienyl]hydrazine.
| Compound Name | 1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E)-2-ethylidenepentyl]-2-[(2E)-2-ethylpenta-2,4-dienyl]hydrazine |
|---|---|
| PubChem CID | 139542240 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | 1-[(Z,2E)-2-ethylidene-3-methylpent-3-enyl]-1-[(2E)-2-ethylidenepentyl]-2-[(2E)-2-ethylpenta-2,4-dienyl]hydrazine |
| SMILES | C=C/C=C(\CC)CNN(C/C(=C/C)CCC)CC(=C/C)/C(C)=C\C |
| InChI | InChI=1S/C22H38N2/c1-8-14-20(11-4)16-23-24(17-21(12-5)15-9-2)18-22(13-6)19(7)10-3/h8,10,12-14,23H,1,9,11,15-18H2,2-7H3/b19-10-,20-14+,21-12+,22-13- |
| InChIKey | NSJYHFNCVJJCFW-SOBYFACNSA-N |
| XLogP | 5.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|