C24H38N2O3 — CID 139542367
(2Z,4E)-3-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]amino]ethyl-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enyl]amino]methyl]hepta-2,4-dien-4-ol (PubChem CID 139542367) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is (2Z,4E)-3-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]amino]ethyl-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enyl]amino]methyl]hepta-2,4-dien-4-ol.
| Compound Name | (2Z,4E)-3-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]amino]ethyl-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enyl]amino]methyl]hepta-2,4-dien-4-ol |
|---|---|
| PubChem CID | 139542367 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | (2Z,4E)-3-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]amino]ethyl-[(E,2Z)-2-ethylidene-3-hydroxypent-3-enyl]amino]methyl]hepta-2,4-dien-4-ol |
| SMILES | C=C/C(O)=C(\C=C)CNCCN(CC(=C/C)/C(O)=C\C)CC(=C/C)/C(O)=C\CC |
| InChI | InChI=1S/C24H38N2O3/c1-7-13-24(29)21(10-4)18-26(17-20(9-3)23(28)12-6)15-14-25-16-19(8-2)22(27)11-5/h8-13,25,27-29H,2,5,7,14-18H2,1,3-4,6H3/b20-9-,21-10-,22-19-,23-12+,24-13+ |
| InChIKey | IFIKTPBBAOAIEG-QMLYVIEDSA-N |
| XLogP | 5.27 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|