C24H36N2O2 — CID 139542379
6-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]-3-methylcyclohexa-1,5-dien-1-ol (PubChem CID 139542379) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 6-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]-3-methylcyclohexa-1,5-dien-1-ol.
| Compound Name | 6-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]-3-methylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 139542379 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 6-[[2-[[(2Z)-2-ethenyl-3-hydroxypenta-2,4-dienyl]amino]ethyl-[(Z,2E)-2-ethylidenepent-3-enyl]amino]methyl]-3-methylcyclohexa-1,5-dien-1-ol |
| SMILES | C=C/C(O)=C(\C=C)CNCCN(CC1=CCC(C)C=C1O)CC(/C=C\C)=C/C |
| InChI | InChI=1S/C24H36N2O2/c1-6-10-20(7-2)17-26(18-22-12-11-19(5)15-24(22)28)14-13-25-16-21(8-3)23(27)9-4/h6-10,12,15,19,25,27-28H,3-4,11,13-14,16-18H2,1-2,5H3/b10-6-,20-7+,23-21- |
| InChIKey | CSCXTSIXGDBPSA-PRPAUNKVSA-N |
| XLogP | 4.99 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|