About 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine
4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine (PubChem CID 139542408) has the molecular formula C22H27FN2O3S
and a molecular weight of 418.53 g/mol. Its IUPAC name is 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine.
Molecular Properties
| Compound Name | 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine |
| PubChem CID | 139542408 |
| Molecular Formula | C22H27FN2O3S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine |
| SMILES | NC1(c2ccc(CN3CCC[C@H](c4ccccc4)S3(=O)=O)c(F)c2)CCOCC1 |
| InChI | InChI=1S/C22H27FN2O3S/c23-20-15-19(22(24)10-13-28-14-11-22)9-8-18(20)16-25-12-4-7-21(29(25,26)27)17-5-2-1-3-6-17/h1-3,5-6,8-9,15,21H,4,7,10-14,16,24H2/t21-/m1/s1 |
| InChIKey | FJHUQEOUCCCHKD-OAQYLSRUSA-N |
| XLogP | 3.46 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine?
The IUPAC name of 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine (CID 139542408) is 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine.
What is the SMILES notation for 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine?
The canonical SMILES for 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine is NC1(c2ccc(CN3CCC[C@H](c4ccccc4)S3(=O)=O)c(F)c2)CCOCC1.
What is the InChIKey of 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine?
The InChIKey is FJHUQEOUCCCHKD-OAQYLSRUSA-N. The full InChI is InChI=1S/C22H27FN2O3S/c23-20-15-19(22(24)10-13-28-14-11-22)9-8-18(20)16-25-12-4-7-21(29(25,26)27)17-5-2-1-3-6-17/h1-3,5-6,8-9,15,21H,4,7,10-14,16,24H2/t21-/m1/s1.
What are the key properties of 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine?
4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine has a molecular weight of 418.53 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[(6R)-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]-3-fluorophenyl]oxan-4-amine is sourced from PubChem (CID 139542408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).