C39H37F7N4O3 — CID 139543368
4-[[4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-3-yl]-7-fluoroindol-1-yl]methyl]-5-methyl-1,3-dioxol-2-ol (PubChem CID 139543368) has the molecular formula C39H37F7N4O3 and a molecular weight of 742.74 g/mol. Its IUPAC name is 4-[[4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-3-yl]-7-fluoroindol-1-yl]methyl]-5-methyl-1,3-dioxol-2-ol.
| Compound Name | 4-[[4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-3-yl]-7-fluoroindol-1-yl]methyl]-5-methyl-1,3-dioxol-2-ol |
|---|---|
| PubChem CID | 139543368 |
| Molecular Formula | C39H37F7N4O3 |
| Molecular Weight | 742.74 g/mol |
| Exact Mass | 742.28 |
| IUPAC Name | 4-[[4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-3-yl]-7-fluoroindol-1-yl]methyl]-5-methyl-1,3-dioxol-2-ol |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1ccc(F)c3c1ccn3CC1=C(C)OC(O)O1)CN(Cc1ccc(C(F)(F)F)cc1C(F)(F)F)C2(C)C |
| InChI | InChI=1S/C39H37F7N4O3/c1-6-22-9-8-10-23(7-2)32(22)50-33(26-13-14-30(40)34-27(26)15-16-48(34)20-31-21(3)52-36(51)53-31)28-19-49(37(4,5)35(28)47-50)18-24-11-12-25(38(41,42)43)17-29(24)39(44,45)46/h8-17,36,51H,6-7,18-20H2,1-5H3 |
| InChIKey | CUYQQXVCVOBXLB-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.74 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |