About 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol
2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol (PubChem CID 139543737) has the molecular formula C22H22FO5P
and a molecular weight of 416.39 g/mol. Its IUPAC name is 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol.
Molecular Properties
| Compound Name | 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol |
| PubChem CID | 139543737 |
| Molecular Formula | C22H22FO5P |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol |
| SMILES | COc1cccc(OC)c1P(c1cccc(F)c1O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C22H22FO5P/c1-25-15-9-6-10-16(26-2)21(15)29(19-13-5-8-14(23)20(19)24)22-17(27-3)11-7-12-18(22)28-4/h5-13,24H,1-4H3 |
| InChIKey | YHHWPRPLHFZTJY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol?
The IUPAC name of 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol (CID 139543737) is 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol.
What is the SMILES notation for 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol?
The canonical SMILES for 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol is COc1cccc(OC)c1P(c1cccc(F)c1O)c1c(OC)cccc1OC.
What is the InChIKey of 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol?
The InChIKey is YHHWPRPLHFZTJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FO5P/c1-25-15-9-6-10-16(26-2)21(15)29(19-13-5-8-14(23)20(19)24)22-17(27-3)11-7-12-18(22)28-4/h5-13,24H,1-4H3.
What are the key properties of 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol?
2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol has a molecular weight of 416.39 g/mol, XLogP of 3.32, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bis(2,6-dimethoxyphenyl)phosphanyl-6-fluorophenol is sourced from PubChem (CID 139543737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).