C32H55N3 — CID 139543862
N'-[(2E,4E)-4-[(2-ethylcyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-yl]-N-(5-ethyl-5-methylnon-1-en-2-yl)hexane-1,6-diamine (PubChem CID 139543862) has the molecular formula C32H55N3 and a molecular weight of 481.81 g/mol. Its IUPAC name is N'-[(2E,4E)-4-[(2-ethylcyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-yl]-N-(5-ethyl-5-methylnon-1-en-2-yl)hexane-1,6-diamine.
| Compound Name | N'-[(2E,4E)-4-[(2-ethylcyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-yl]-N-(5-ethyl-5-methylnon-1-en-2-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 139543862 |
| Molecular Formula | C32H55N3 |
| Molecular Weight | 481.81 g/mol |
| Exact Mass | 481.44 |
| IUPAC Name | N'-[(2E,4E)-4-[(2-ethylcyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-yl]-N-(5-ethyl-5-methylnon-1-en-2-yl)hexane-1,6-diamine |
| SMILES | C=C(CCC(C)(CC)CCCC)NCCCCCCNC(=C/C)/C(=C\C)/N=C1\CC=CC=C1CC |
| InChI | InChI=1S/C32H55N3/c1-8-13-23-32(7,12-5)24-22-27(6)33-25-18-14-15-19-26-34-29(10-3)30(11-4)35-31-21-17-16-20-28(31)9-2/h10-11,16-17,20,33-34H,6,8-9,12-15,18-19,21-26H2,1-5,7H3/b29-10+,30-11+,35-31+ |
| InChIKey | KXJYZNYGSBIEEB-MORCFURZSA-N |
| XLogP | 9.17 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.81 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|