C35H59N3 — CID 139543865
N'-[(2E,4E)-4-[(2-ethylcyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-yl]-N-(5,5,8,8,9-pentamethyldeca-1,9-dien-2-yl)hexane-1,6-diamine (PubChem CID 139543865) has the molecular formula C35H59N3 and a molecular weight of 521.88 g/mol. Its IUPAC name is N'-[(2E,4E)-4-[(2-ethylcyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-yl]-N-(5,5,8,8,9-pentamethyldeca-1,9-dien-2-yl)hexane-1,6-diamine.
| Compound Name | N'-[(2E,4E)-4-[(2-ethylcyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-yl]-N-(5,5,8,8,9-pentamethyldeca-1,9-dien-2-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 139543865 |
| Molecular Formula | C35H59N3 |
| Molecular Weight | 521.88 g/mol |
| Exact Mass | 521.47 |
| IUPAC Name | N'-[(2E,4E)-4-[(2-ethylcyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-yl]-N-(5,5,8,8,9-pentamethyldeca-1,9-dien-2-yl)hexane-1,6-diamine |
| SMILES | C=C(CCC(C)(C)CCC(C)(C)C(=C)C)NCCCCCCNC(=C/C)/C(=C\C)/N=C1\CC=CC=C1CC |
| InChI | InChI=1S/C35H59N3/c1-11-30-20-16-17-21-33(30)38-32(13-3)31(12-2)37-27-19-15-14-18-26-36-29(6)22-23-34(7,8)24-25-35(9,10)28(4)5/h12-13,16-17,20,36-37H,4,6,11,14-15,18-19,21-27H2,1-3,5,7-10H3/b31-12+,32-13+,38-33+ |
| InChIKey | VQTDSINWPPBCIN-BMMPTUNUSA-N |
| XLogP | 9.97 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.88 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|