C9H13NO — CID 139544144
5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-1,4-oxazine (PubChem CID 139544144) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-1,4-oxazine.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-1,4-oxazine |
|---|---|
| PubChem CID | 139544144 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-1,4-oxazine |
| SMILES | C=C/C=C\C1=C(C)OCCN1 |
| InChI | InChI=1S/C9H13NO/c1-3-4-5-9-8(2)11-7-6-10-9/h3-5,10H,1,6-7H2,2H3/b5-4- |
| InChIKey | SBEZUBNMIBAWBX-PLNGDYQASA-N |
| XLogP | 1.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|