C10H9F5N2O2 — CID 139544212
2-[(2S,4R)-5,5-difluoro-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]ethane-1,1-diol (PubChem CID 139544212) has the molecular formula C10H9F5N2O2 and a molecular weight of 284.18 g/mol. Its IUPAC name is 2-[(2S,4R)-5,5-difluoro-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]ethane-1,1-diol.
| Compound Name | 2-[(2S,4R)-5,5-difluoro-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 139544212 |
| Molecular Formula | C10H9F5N2O2 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-[(2S,4R)-5,5-difluoro-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]ethane-1,1-diol |
| SMILES | OC(O)Cn1nc(C(F)(F)F)c2c1C(F)(F)[C@@H]1C[C@H]21 |
| InChI | InChI=1S/C10H9F5N2O2/c11-9(12)4-1-3(4)6-7(10(13,14)15)16-17(8(6)9)2-5(18)19/h3-5,18-19H,1-2H2/t3-,4+/m0/s1 |
| InChIKey | MSBVJSCWNVGCPN-IUYQGCFVSA-N |
| XLogP | 1.42 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|