C30H18O6 — CID 139544915
methyl 4-[9-(1,3-dioxo-2-benzofuran-5-yl)fluoren-9-yl]-2-formylbenzoate (PubChem CID 139544915) has the molecular formula C30H18O6 and a molecular weight of 474.47 g/mol. Its IUPAC name is methyl 4-[9-(1,3-dioxo-2-benzofuran-5-yl)fluoren-9-yl]-2-formylbenzoate.
| Compound Name | methyl 4-[9-(1,3-dioxo-2-benzofuran-5-yl)fluoren-9-yl]-2-formylbenzoate |
|---|---|
| PubChem CID | 139544915 |
| Molecular Formula | C30H18O6 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | methyl 4-[9-(1,3-dioxo-2-benzofuran-5-yl)fluoren-9-yl]-2-formylbenzoate |
| SMILES | COC(=O)c1ccc(C2(c3ccc4c(c3)C(=O)OC4=O)c3ccccc3-c3ccccc32)cc1C=O |
| InChI | InChI=1S/C30H18O6/c1-35-27(32)20-12-10-18(14-17(20)16-31)30(19-11-13-23-24(15-19)29(34)36-28(23)33)25-8-4-2-6-21(25)22-7-3-5-9-26(22)30/h2-16H,1H3 |
| InChIKey | BMNIDNQNFWCSDX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|