C7H11F8N3O6S3 — CID 139545655
1,1-difluoro-N'-(trifluoromethylsulfonyl)-N-[2-(3,3,3-trifluoropropylamino)ethyl]methanedisulfonamide (PubChem CID 139545655) has the molecular formula C7H11F8N3O6S3 and a molecular weight of 481.37 g/mol. Its IUPAC name is 1,1-difluoro-N'-(trifluoromethylsulfonyl)-N-[2-(3,3,3-trifluoropropylamino)ethyl]methanedisulfonamide.
| Compound Name | 1,1-difluoro-N'-(trifluoromethylsulfonyl)-N-[2-(3,3,3-trifluoropropylamino)ethyl]methanedisulfonamide |
|---|---|
| PubChem CID | 139545655 |
| Molecular Formula | C7H11F8N3O6S3 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.97 |
| IUPAC Name | 1,1-difluoro-N'-(trifluoromethylsulfonyl)-N-[2-(3,3,3-trifluoropropylamino)ethyl]methanedisulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)S(=O)(=O)NCCNCCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H11F8N3O6S3/c8-5(9,10)1-2-16-3-4-17-26(21,22)7(14,15)27(23,24)18-25(19,20)6(11,12)13/h16-18H,1-4H2 |
| InChIKey | SMSBVNMWPJKNSC-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|