About 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one
6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one (PubChem CID 139546847) has the molecular formula C21H34O5S
and a molecular weight of 398.57 g/mol. Its IUPAC name is 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one.
Molecular Properties
| Compound Name | 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one |
| PubChem CID | 139546847 |
| Molecular Formula | C21H34O5S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one |
| SMILES | COC(OCCC(C)(C)C(=O)CCS(=O)(=O)c1ccc(C)cc1)C(C)(C)C |
| InChI | InChI=1S/C21H34O5S/c1-16-8-10-17(11-9-16)27(23,24)15-12-18(22)21(5,6)13-14-26-19(25-7)20(2,3)4/h8-11,19H,12-15H2,1-7H3 |
| InChIKey | QHBIELHKFKHVMN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one?
The IUPAC name of 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one (CID 139546847) is 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one.
What is the SMILES notation for 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one?
The canonical SMILES for 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one is COC(OCCC(C)(C)C(=O)CCS(=O)(=O)c1ccc(C)cc1)C(C)(C)C.
What is the InChIKey of 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one?
The InChIKey is QHBIELHKFKHVMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34O5S/c1-16-8-10-17(11-9-16)27(23,24)15-12-18(22)21(5,6)13-14-26-19(25-7)20(2,3)4/h8-11,19H,12-15H2,1-7H3.
What are the key properties of 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one?
6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one has a molecular weight of 398.57 g/mol, XLogP of 4.18, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-methoxy-2,2-dimethylpropoxy)-4,4-dimethyl-1-(4-methylphenyl)sulfonylhexan-3-one is sourced from PubChem (CID 139546847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).