About 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine
2-iodo-N'-piperidin-4-ylpropane-1,3-diamine (PubChem CID 139547887) has the molecular formula C8H18IN3
and a molecular weight of 283.16 g/mol. Its IUPAC name is 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine |
| PubChem CID | 139547887 |
| Molecular Formula | C8H18IN3 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine |
| SMILES | NCC(I)CNC1CCNCC1 |
| InChI | InChI=1S/C8H18IN3/c9-7(5-10)6-12-8-1-3-11-4-2-8/h7-8,11-12H,1-6,10H2 |
| InChIKey | MYFCUJQQDLNZQA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine?
The IUPAC name of 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine (CID 139547887) is 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine.
What is the SMILES notation for 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine?
The canonical SMILES for 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine is NCC(I)CNC1CCNCC1.
What is the InChIKey of 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine?
The InChIKey is MYFCUJQQDLNZQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18IN3/c9-7(5-10)6-12-8-1-3-11-4-2-8/h7-8,11-12H,1-6,10H2.
What are the key properties of 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine?
2-iodo-N'-piperidin-4-ylpropane-1,3-diamine has a molecular weight of 283.16 g/mol, XLogP of 0.09, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-N'-piperidin-4-ylpropane-1,3-diamine is sourced from PubChem (CID 139547887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).