C17H16ClF3N4O2 — CID 139547947
1-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]-2-[4-(trifluoromethoxy)phenyl]ethanone (PubChem CID 139547947) has the molecular formula C17H16ClF3N4O2 and a molecular weight of 400.79 g/mol. Its IUPAC name is 1-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]-2-[4-(trifluoromethoxy)phenyl]ethanone.
| Compound Name | 1-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]-2-[4-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 139547947 |
| Molecular Formula | C17H16ClF3N4O2 |
| Molecular Weight | 400.79 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]-2-[4-(trifluoromethoxy)phenyl]ethanone |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)N1CCN(c2ccc(Cl)nn2)CC1 |
| InChI | InChI=1S/C17H16ClF3N4O2/c18-14-5-6-15(23-22-14)24-7-9-25(10-8-24)16(26)11-12-1-3-13(4-2-12)27-17(19,20)21/h1-6H,7-11H2 |
| InChIKey | ARBMSPPXUVUNMB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |