C10H22N2 — CID 139548079
(2R,3R)-1,2,3-trimethyl-4-propan-2-ylpiperazine (PubChem CID 139548079) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is (2R,3R)-1,2,3-trimethyl-4-propan-2-ylpiperazine.
| Compound Name | (2R,3R)-1,2,3-trimethyl-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 139548079 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (2R,3R)-1,2,3-trimethyl-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(C)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C10H22N2/c1-8(2)12-7-6-11(5)9(3)10(12)4/h8-10H,6-7H2,1-5H3/t9-,10-/m1/s1 |
| InChIKey | LBAKKFLARWTOJT-NXEZZACHSA-N |
| XLogP | 1.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |