About (2-methylcyclopropyl) thiohypochlorite
(2-methylcyclopropyl) thiohypochlorite (PubChem CID 139548096) has the molecular formula C4H7ClS
and a molecular weight of 122.62 g/mol. Its IUPAC name is (2-methylcyclopropyl) thiohypochlorite.
Molecular Properties
| Compound Name | (2-methylcyclopropyl) thiohypochlorite |
| PubChem CID | 139548096 |
| Molecular Formula | C4H7ClS |
| Molecular Weight | 122.62 g/mol |
| Exact Mass | 122.00 |
| IUPAC Name | (2-methylcyclopropyl) thiohypochlorite |
| SMILES | CC1CC1SCl |
| InChI | InChI=1S/C4H7ClS/c1-3-2-4(3)6-5/h3-4H,2H2,1H3 |
| InChIKey | LEMFZVLVMDAGEK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.62 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-methylcyclopropyl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclopropyl) thiohypochlorite?
The IUPAC name of (2-methylcyclopropyl) thiohypochlorite (CID 139548096) is (2-methylcyclopropyl) thiohypochlorite.
What is the SMILES notation for (2-methylcyclopropyl) thiohypochlorite?
The canonical SMILES for (2-methylcyclopropyl) thiohypochlorite is CC1CC1SCl.
What is the InChIKey of (2-methylcyclopropyl) thiohypochlorite?
The InChIKey is LEMFZVLVMDAGEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClS/c1-3-2-4(3)6-5/h3-4H,2H2,1H3.
What are the key properties of (2-methylcyclopropyl) thiohypochlorite?
(2-methylcyclopropyl) thiohypochlorite has a molecular weight of 122.62 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclopropyl) thiohypochlorite is sourced from PubChem (CID 139548096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).