C25H33ClN2O4 — CID 139548578
4-[(6R)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6-methyl-2-oxo-1,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-3-yl]pent-4-enoic acid (PubChem CID 139548578) has the molecular formula C25H33ClN2O4 and a molecular weight of 461.00 g/mol. Its IUPAC name is 4-[(6R)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6-methyl-2-oxo-1,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-3-yl]pent-4-enoic acid.
| Compound Name | 4-[(6R)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6-methyl-2-oxo-1,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-3-yl]pent-4-enoic acid |
|---|---|
| PubChem CID | 139548578 |
| Molecular Formula | C25H33ClN2O4 |
| Molecular Weight | 461.00 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 4-[(6R)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-6-methyl-2-oxo-1,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-3-yl]pent-4-enoic acid |
| SMILES | C=C(CCC(=O)O)N1C=C2C[C@@H](C)OCC2(c2ccc(CCC(C)(C)C)c(Cl)c2)NC1=O |
| InChI | InChI=1S/C25H33ClN2O4/c1-16(6-9-22(29)30)28-14-20-12-17(2)32-15-25(20,27-23(28)31)19-8-7-18(21(26)13-19)10-11-24(3,4)5/h7-8,13-14,17H,1,6,9-12,15H2,2-5H3,(H,27,31)(H,29,30)/t17-,25?/m1/s1 |
| InChIKey | FIBMAUBSPXUVHC-SMFUYQKNSA-N |
| XLogP | 5.61 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.00 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |