About 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene
4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene (PubChem CID 139549033) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene.
Molecular Properties
| Compound Name | 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene |
| PubChem CID | 139549033 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene |
| SMILES | C/C=C\C1=C(/C=C\C)C(C)(C)CC2OC12 |
| InChI | InChI=1S/C14H20O/c1-5-7-10-11(8-6-2)14(3,4)9-12-13(10)15-12/h5-8,12-13H,9H2,1-4H3/b7-5-,8-6- |
| InChIKey | BLMLDKVYUJWPSW-SFECMWDFSA-N |
| XLogP | 3.63 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene?
The IUPAC name of 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene (CID 139549033) is 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene.
What is the SMILES notation for 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene?
The canonical SMILES for 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene is C/C=C\C1=C(/C=C\C)C(C)(C)CC2OC12.
What is the InChIKey of 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene?
The InChIKey is BLMLDKVYUJWPSW-SFECMWDFSA-N. The full InChI is InChI=1S/C14H20O/c1-5-7-10-11(8-6-2)14(3,4)9-12-13(10)15-12/h5-8,12-13H,9H2,1-4H3/b7-5-,8-6-.
What are the key properties of 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene?
4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene has a molecular weight of 204.31 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2,3-bis[(Z)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-2-ene is sourced from PubChem (CID 139549033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).