About 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid
2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid (PubChem CID 139550313) has the molecular formula C15H9F2NO6S2
and a molecular weight of 401.37 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid |
| PubChem CID | 139550313 |
| Molecular Formula | C15H9F2NO6S2 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid |
| SMILES | CN(c1cc2oc(=O)c(C(=O)O)cc2s1)S(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H9F2NO6S2/c1-18(26(22,23)9-3-7(16)2-8(17)4-9)13-6-11-12(25-13)5-10(14(19)20)15(21)24-11/h2-6H,1H3,(H,19,20) |
| InChIKey | WHJGXMVGWIAJJA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid?
The IUPAC name of 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid (CID 139550313) is 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid.
What is the SMILES notation for 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid?
The canonical SMILES for 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid is CN(c1cc2oc(=O)c(C(=O)O)cc2s1)S(=O)(=O)c1cc(F)cc(F)c1.
What is the InChIKey of 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid?
The InChIKey is WHJGXMVGWIAJJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F2NO6S2/c1-18(26(22,23)9-3-7(16)2-8(17)4-9)13-6-11-12(25-13)5-10(14(19)20)15(21)24-11/h2-6H,1H3,(H,19,20).
What are the key properties of 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid?
2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid has a molecular weight of 401.37 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-difluorophenyl)sulfonyl-methylamino]-5-oxothieno[3,2-b]pyran-6-carboxylic acid is sourced from PubChem (CID 139550313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).