C38H30N4 — CID 139550439
4,6-di(carbazol-9-yl)-2,5-di(propan-2-yl)benzene-1,3-dicarbonitrile (PubChem CID 139550439) has the molecular formula C38H30N4 and a molecular weight of 542.69 g/mol. Its IUPAC name is 4,6-di(carbazol-9-yl)-2,5-di(propan-2-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 4,6-di(carbazol-9-yl)-2,5-di(propan-2-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139550439 |
| Molecular Formula | C38H30N4 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 4,6-di(carbazol-9-yl)-2,5-di(propan-2-yl)benzene-1,3-dicarbonitrile |
| SMILES | CC(C)c1c(C#N)c(-n2c3ccccc3c3ccccc32)c(C(C)C)c(-n2c3ccccc3c3ccccc32)c1C#N |
| InChI | InChI=1S/C38H30N4/c1-23(2)35-29(21-39)37(41-31-17-9-5-13-25(31)26-14-6-10-18-32(26)41)36(24(3)4)38(30(35)22-40)42-33-19-11-7-15-27(33)28-16-8-12-20-34(28)42/h5-20,23-24H,1-4H3 |
| InChIKey | RIPAFMATBFAGBG-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |