C14H20IN — CID 139550944
1-(3,4-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-iodoethanamine (PubChem CID 139550944) has the molecular formula C14H20IN and a molecular weight of 329.23 g/mol. Its IUPAC name is 1-(3,4-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-iodoethanamine.
| Compound Name | 1-(3,4-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-iodoethanamine |
|---|---|
| PubChem CID | 139550944 |
| Molecular Formula | C14H20IN |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-(3,4-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2-iodoethanamine |
| SMILES | CC1CC(C(N)CI)c2ccccc2C1C |
| InChI | InChI=1S/C14H20IN/c1-9-7-13(14(16)8-15)12-6-4-3-5-11(12)10(9)2/h3-6,9-10,13-14H,7-8,16H2,1-2H3 |
| InChIKey | CPGIKRXCRURSHH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|