About 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene
6-iodo-3-methyl-3-phenyl-1,2-dihydroindene (PubChem CID 139551020) has the molecular formula C16H15I
and a molecular weight of 334.20 g/mol. Its IUPAC name is 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene.
Molecular Properties
| Compound Name | 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene |
| PubChem CID | 139551020 |
| Molecular Formula | C16H15I |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene |
| SMILES | CC1(c2ccccc2)CCc2cc(I)ccc21 |
| InChI | InChI=1S/C16H15I/c1-16(13-5-3-2-4-6-13)10-9-12-11-14(17)7-8-15(12)16/h2-8,11H,9-10H2,1H3 |
| InChIKey | ZOWXJVXIZGMNKT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene?
The IUPAC name of 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene (CID 139551020) is 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene.
What is the SMILES notation for 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene?
The canonical SMILES for 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene is CC1(c2ccccc2)CCc2cc(I)ccc21.
What is the InChIKey of 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene?
The InChIKey is ZOWXJVXIZGMNKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15I/c1-16(13-5-3-2-4-6-13)10-9-12-11-14(17)7-8-15(12)16/h2-8,11H,9-10H2,1H3.
What are the key properties of 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene?
6-iodo-3-methyl-3-phenyl-1,2-dihydroindene has a molecular weight of 334.20 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-3-methyl-3-phenyl-1,2-dihydroindene is sourced from PubChem (CID 139551020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).