C15H21N3 — CID 139551200
2,4,6-trimethylidene-1,3,5-tris(prop-2-enyl)-1,3,5-triazinane (PubChem CID 139551200) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2,4,6-trimethylidene-1,3,5-tris(prop-2-enyl)-1,3,5-triazinane.
| Compound Name | 2,4,6-trimethylidene-1,3,5-tris(prop-2-enyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 139551200 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2,4,6-trimethylidene-1,3,5-tris(prop-2-enyl)-1,3,5-triazinane |
| SMILES | C=CCN1C(=C)N(CC=C)C(=C)N(CC=C)C1=C |
| InChI | InChI=1S/C15H21N3/c1-7-10-16-13(4)17(11-8-2)15(6)18(12-9-3)14(16)5/h7-9H,1-6,10-12H2 |
| InChIKey | QRBCTQBWKGLXGD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|