C28H53N7O8 — CID 139551234
tert-butyl N-[N'-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propylamino]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 139551234) has the molecular formula C28H53N7O8 and a molecular weight of 615.77 g/mol. Its IUPAC name is tert-butyl N-[N'-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propylamino]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propylamino]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 139551234 |
| Molecular Formula | C28H53N7O8 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.40 |
| IUPAC Name | tert-butyl N-[N'-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propylamino]propyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCNCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H53N7O8/c1-25(2,3)40-21(36)32-19(33-22(37)41-26(4,5)6)30-17-13-15-29-16-14-18-31-20(34-23(38)42-27(7,8)9)35-24(39)43-28(10,11)12/h29H,13-18H2,1-12H3,(H2,30,32,33,36,37)(H2,31,34,35,38,39) |
| InChIKey | VJNJRRIQYXHVDX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 190.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|