C16H25N3 — CID 139551485
1-cyclohexa-2,4-dien-1-yl-N'-[cyclohexa-2,4-dien-1-yl(ethylamino)methyl]methanediamine (PubChem CID 139551485) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-N'-[cyclohexa-2,4-dien-1-yl(ethylamino)methyl]methanediamine.
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-N'-[cyclohexa-2,4-dien-1-yl(ethylamino)methyl]methanediamine |
|---|---|
| PubChem CID | 139551485 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-N'-[cyclohexa-2,4-dien-1-yl(ethylamino)methyl]methanediamine |
| SMILES | CCNC(NC(N)C1C=CC=CC1)C1C=CC=CC1 |
| InChI | InChI=1S/C16H25N3/c1-2-18-16(14-11-7-4-8-12-14)19-15(17)13-9-5-3-6-10-13/h3-9,11,13-16,18-19H,2,10,12,17H2,1H3 |
| InChIKey | VPGVTDMJMBLTKD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|