C19H23N5S2 — CID 139551703
4-[(4Z,6Z)-nona-4,6,8-trienyl]sulfanyl-6-(2-pyridin-2-ylethylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 139551703) has the molecular formula C19H23N5S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is 4-[(4Z,6Z)-nona-4,6,8-trienyl]sulfanyl-6-(2-pyridin-2-ylethylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[(4Z,6Z)-nona-4,6,8-trienyl]sulfanyl-6-(2-pyridin-2-ylethylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 139551703 |
| Molecular Formula | C19H23N5S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-[(4Z,6Z)-nona-4,6,8-trienyl]sulfanyl-6-(2-pyridin-2-ylethylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | C=C/C=C\C=C/CCCSc1nc(N)nc(SCCc2ccccn2)n1 |
| InChI | InChI=1S/C19H23N5S2/c1-2-3-4-5-6-7-10-14-25-18-22-17(20)23-19(24-18)26-15-12-16-11-8-9-13-21-16/h2-6,8-9,11,13H,1,7,10,12,14-15H2,(H2,20,22,23,24)/b4-3-,6-5- |
| InChIKey | SJYVIRDQMDCICO-OUPQRBNQSA-N |
| XLogP | 4.35 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|