About 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one
8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one (PubChem CID 139551966) has the molecular formula C25H19ClN4O2
and a molecular weight of 442.91 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one.
Molecular Properties
| Compound Name | 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one |
| PubChem CID | 139551966 |
| Molecular Formula | C25H19ClN4O2 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one |
| SMILES | Cn1cc2cc(-n3cc4ccc(OC5CC5)nc4c(-c4ccc(Cl)cc4)c3=O)ccc2n1 |
| InChI | InChI=1S/C25H19ClN4O2/c1-29-13-17-12-19(7-10-21(17)28-29)30-14-16-4-11-22(32-20-8-9-20)27-24(16)23(25(30)31)15-2-5-18(26)6-3-15/h2-7,10-14,20H,8-9H2,1H3 |
| InChIKey | HVKVAKPAYGHQQL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one?
The IUPAC name of 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one (CID 139551966) is 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one.
What is the SMILES notation for 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one?
The canonical SMILES for 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one is Cn1cc2cc(-n3cc4ccc(OC5CC5)nc4c(-c4ccc(Cl)cc4)c3=O)ccc2n1.
What is the InChIKey of 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one?
The InChIKey is HVKVAKPAYGHQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19ClN4O2/c1-29-13-17-12-19(7-10-21(17)28-29)30-14-16-4-11-22(32-20-8-9-20)27-24(16)23(25(30)31)15-2-5-18(26)6-3-15/h2-7,10-14,20H,8-9H2,1H3.
What are the key properties of 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one?
8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one has a molecular weight of 442.91 g/mol, XLogP of 5.13, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-chlorophenyl)-2-cyclopropyloxy-6-(2-methylindazol-5-yl)-1,6-naphthyridin-7-one is sourced from PubChem (CID 139551966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).