C26H37NO9P2 — CID 139552248
[4-[[4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenoxy]methyl]-2-methyl-5H-1,3-oxazol-4-yl]methanol (PubChem CID 139552248) has the molecular formula C26H37NO9P2 and a molecular weight of 569.53 g/mol. Its IUPAC name is [4-[[4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenoxy]methyl]-2-methyl-5H-1,3-oxazol-4-yl]methanol.
| Compound Name | [4-[[4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenoxy]methyl]-2-methyl-5H-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 139552248 |
| Molecular Formula | C26H37NO9P2 |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | [4-[[4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenoxy]methyl]-2-methyl-5H-1,3-oxazol-4-yl]methanol |
| SMILES | COP(=O)(CCc1cc(CCP(=O)(OC)OC)cc(-c2ccc(OCC3(CO)COC(C)=N3)cc2)c1)OC |
| InChI | InChI=1S/C26H37NO9P2/c1-20-27-26(17-28,18-35-20)19-36-25-8-6-23(7-9-25)24-15-21(10-12-37(29,31-2)32-3)14-22(16-24)11-13-38(30,33-4)34-5/h6-9,14-16,28H,10-13,17-19H2,1-5H3 |
| InChIKey | OLHDBCZKMCVERE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|