About 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine
4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 139552345) has the molecular formula C21H15FN4O
and a molecular weight of 358.38 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 139552345 |
| Molecular Formula | C21H15FN4O |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Fc1ccc(-c2ncn(Cc3ccoc3)c2-c2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C21H15FN4O/c22-16-3-1-15(2-4-16)19-20(17-5-8-23-21-18(17)6-9-24-21)26(13-25-19)11-14-7-10-27-12-14/h1-10,12-13H,11H2,(H,23,24) |
| InChIKey | IXPDBUFKQRVFHP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine (CID 139552345) is 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine is Fc1ccc(-c2ncn(Cc3ccoc3)c2-c2ccnc3[nH]ccc23)cc1.
What is the InChIKey of 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is IXPDBUFKQRVFHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15FN4O/c22-16-3-1-15(2-4-16)19-20(17-5-8-23-21-18(17)6-9-24-21)26(13-25-19)11-14-7-10-27-12-14/h1-10,12-13H,11H2,(H,23,24).
What are the key properties of 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine?
4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 358.38 g/mol, XLogP of 4.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-fluorophenyl)-3-(furan-3-ylmethyl)imidazol-4-yl]-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 139552345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).