C25H24F2N6O2 — CID 139552360
6-[4-amino-3-(methyliminomethyl)phenyl]-8-[4-(1,1-difluoroethoxy)phenyl]-2-(ethylamino)pyrido[4,3-d]pyrimidin-7-one (PubChem CID 139552360) has the molecular formula C25H24F2N6O2 and a molecular weight of 478.50 g/mol. Its IUPAC name is 6-[4-amino-3-(methyliminomethyl)phenyl]-8-[4-(1,1-difluoroethoxy)phenyl]-2-(ethylamino)pyrido[4,3-d]pyrimidin-7-one.
| Compound Name | 6-[4-amino-3-(methyliminomethyl)phenyl]-8-[4-(1,1-difluoroethoxy)phenyl]-2-(ethylamino)pyrido[4,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 139552360 |
| Molecular Formula | C25H24F2N6O2 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 6-[4-amino-3-(methyliminomethyl)phenyl]-8-[4-(1,1-difluoroethoxy)phenyl]-2-(ethylamino)pyrido[4,3-d]pyrimidin-7-one |
| SMILES | CCNc1ncc2cn(-c3ccc(N)c(/C=N/C)c3)c(=O)c(-c3ccc(OC(C)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C25H24F2N6O2/c1-4-30-24-31-13-17-14-33(18-7-10-20(28)16(11-18)12-29-3)23(34)21(22(17)32-24)15-5-8-19(9-6-15)35-25(2,26)27/h5-14H,4,28H2,1-3H3,(H,30,32)/b29-12+ |
| InChIKey | BYCWJIXGFULHJP-XKJRVUDJSA-N |
| XLogP | 4.50 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|