C21H22F2N6O2 — CID 139552530
(6R)-6-ethyl-9,15-difluoro-13-oxa-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one (PubChem CID 139552530) has the molecular formula C21H22F2N6O2 and a molecular weight of 428.44 g/mol. Its IUPAC name is (6R)-6-ethyl-9,15-difluoro-13-oxa-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one.
| Compound Name | (6R)-6-ethyl-9,15-difluoro-13-oxa-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one |
|---|---|
| PubChem CID | 139552530 |
| Molecular Formula | C21H22F2N6O2 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (6R)-6-ethyl-9,15-difluoro-13-oxa-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one |
| SMILES | CC[C@]12CCCN1c1ccn3ncc(c3n1)C(=O)NCC(F)COc1ncc(F)cc12 |
| InChI | InChI=1S/C21H22F2N6O2/c1-2-21-5-3-6-28(21)17-4-7-29-18(27-17)15(11-26-29)19(30)24-10-14(23)12-31-20-16(21)8-13(22)9-25-20/h4,7-9,11,14H,2-3,5-6,10,12H2,1H3,(H,24,30)/t14?,21-/m1/s1 |
| InChIKey | SQKZEWDVAPJKEL-OKKPIIHCSA-N |
| XLogP | 2.63 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |