C21H20FN5O2 — CID 139552558
10-fluoro-16-methyl-14-oxa-2,17,21,25,26-pentazahexacyclo[17.5.2.02,7.05,7.08,13.022,26]hexacosa-1(25),8(13),9,11,19,21,23-heptaen-18-one (PubChem CID 139552558) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is 10-fluoro-16-methyl-14-oxa-2,17,21,25,26-pentazahexacyclo[17.5.2.02,7.05,7.08,13.022,26]hexacosa-1(25),8(13),9,11,19,21,23-heptaen-18-one.
| Compound Name | 10-fluoro-16-methyl-14-oxa-2,17,21,25,26-pentazahexacyclo[17.5.2.02,7.05,7.08,13.022,26]hexacosa-1(25),8(13),9,11,19,21,23-heptaen-18-one |
|---|---|
| PubChem CID | 139552558 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 10-fluoro-16-methyl-14-oxa-2,17,21,25,26-pentazahexacyclo[17.5.2.02,7.05,7.08,13.022,26]hexacosa-1(25),8(13),9,11,19,21,23-heptaen-18-one |
| SMILES | CC1COc2ccc(F)cc2C23CC2CCN3c2ccc3ncc(n3n2)C(=O)N1 |
| InChI | InChI=1S/C21H20FN5O2/c1-12-11-29-17-3-2-14(22)8-15(17)21-9-13(21)6-7-26(21)19-5-4-18-23-10-16(20(28)24-12)27(18)25-19/h2-5,8,10,12-13H,6-7,9,11H2,1H3,(H,24,28) |
| InChIKey | RABXNQQVJZYROL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |