C20H19FN6O2 — CID 139552838
(15S)-10-fluoro-15-methyl-14-oxa-2,12,17,21,25,26-hexazahexacyclo[17.5.2.02,7.05,7.08,13.022,26]hexacosa-1(25),8(13),9,11,19,21,23-heptaen-18-one (PubChem CID 139552838) has the molecular formula C20H19FN6O2 and a molecular weight of 394.41 g/mol. Its IUPAC name is (15S)-10-fluoro-15-methyl-14-oxa-2,12,17,21,25,26-hexazahexacyclo[17.5.2.02,7.05,7.08,13.022,26]hexacosa-1(25),8(13),9,11,19,21,23-heptaen-18-one.
| Compound Name | (15S)-10-fluoro-15-methyl-14-oxa-2,12,17,21,25,26-hexazahexacyclo[17.5.2.02,7.05,7.08,13.022,26]hexacosa-1(25),8(13),9,11,19,21,23-heptaen-18-one |
|---|---|
| PubChem CID | 139552838 |
| Molecular Formula | C20H19FN6O2 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (15S)-10-fluoro-15-methyl-14-oxa-2,12,17,21,25,26-hexazahexacyclo[17.5.2.02,7.05,7.08,13.022,26]hexacosa-1(25),8(13),9,11,19,21,23-heptaen-18-one |
| SMILES | C[C@H]1CNC(=O)c2cnc3ccc(nn23)N2CCC3CC32c2cc(F)cnc2O1 |
| InChI | InChI=1S/C20H19FN6O2/c1-11-8-23-18(28)15-10-22-16-2-3-17(25-27(15)16)26-5-4-12-7-20(12,26)14-6-13(21)9-24-19(14)29-11/h2-3,6,9-12H,4-5,7-8H2,1H3,(H,23,28)/t11-,12?,20?/m0/s1 |
| InChIKey | UYAJMRWZYKCZNV-IDOXEUFTSA-N |
| XLogP | 1.90 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |