C58H34N4O2 — CID 139553225
4-[5-(4-cyanophenyl)-2,4-dimethyl-3,6-bis(9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)phenyl]benzonitrile (PubChem CID 139553225) has the molecular formula C58H34N4O2 and a molecular weight of 818.94 g/mol. Its IUPAC name is 4-[5-(4-cyanophenyl)-2,4-dimethyl-3,6-bis(9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)phenyl]benzonitrile.
| Compound Name | 4-[5-(4-cyanophenyl)-2,4-dimethyl-3,6-bis(9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 139553225 |
| Molecular Formula | C58H34N4O2 |
| Molecular Weight | 818.94 g/mol |
| Exact Mass | 818.27 |
| IUPAC Name | 4-[5-(4-cyanophenyl)-2,4-dimethyl-3,6-bis(9-oxa-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaen-14-yl)phenyl]benzonitrile |
| SMILES | Cc1c(-c2ccc(C#N)cc2)c(-n2c3ccccc3c3c4c(ccc32)oc2ccccc24)c(-c2ccc(C#N)cc2)c(C)c1-n1c2ccccc2c2c3c(ccc21)oc1ccccc13 |
| InChI | InChI=1S/C58H34N4O2/c1-33-51(37-23-19-35(31-59)20-24-37)58(62-44-16-8-4-12-40(44)54-46(62)28-30-50-56(54)42-14-6-10-18-48(42)64-50)52(38-25-21-36(32-60)22-26-38)34(2)57(33)61-43-15-7-3-11-39(43)53-45(61)27-29-49-55(53)41-13-5-9-17-47(41)63-49/h3-30H,1-2H3 |
| InChIKey | OQIDPWGLMHQAGI-UHFFFAOYSA-N |
| XLogP | 15.37 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.94 |
| LogP ≤ 5 | 15.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |