C21H24N8O6 — CID 139553263
N-[2-methoxy-3-[2-(4-methyl-3-oxopyrido[2,3-b]pyrazin-6-yl)oxyethylamino]propyl]-N-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)formamide (PubChem CID 139553263) has the molecular formula C21H24N8O6 and a molecular weight of 484.47 g/mol. Its IUPAC name is N-[2-methoxy-3-[2-(4-methyl-3-oxopyrido[2,3-b]pyrazin-6-yl)oxyethylamino]propyl]-N-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)formamide.
| Compound Name | N-[2-methoxy-3-[2-(4-methyl-3-oxopyrido[2,3-b]pyrazin-6-yl)oxyethylamino]propyl]-N-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)formamide |
|---|---|
| PubChem CID | 139553263 |
| Molecular Formula | C21H24N8O6 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[2-methoxy-3-[2-(4-methyl-3-oxopyrido[2,3-b]pyrazin-6-yl)oxyethylamino]propyl]-N-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)formamide |
| SMILES | COC(CNCCOc1ccc2ncc(=O)n(C)c2n1)CN(C=O)c1cnc2c(n1)NC(=O)CO2 |
| InChI | InChI=1S/C21H24N8O6/c1-28-18(32)9-23-14-3-4-17(27-20(14)28)34-6-5-22-7-13(33-2)10-29(12-30)15-8-24-21-19(25-15)26-16(31)11-35-21/h3-4,8-9,12-13,22H,5-7,10-11H2,1-2H3,(H,25,26,31) |
| InChIKey | JALWILBIOKVECG-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 162.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|