C15H22N2O3 — CID 139554316
1-hydroxy-6-[(1R,2S,4S)-3-(2-hydroxyethylamino)-2-bicyclo[2.2.1]heptanyl]-4-methylpyridin-2-one (PubChem CID 139554316) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-hydroxy-6-[(1R,2S,4S)-3-(2-hydroxyethylamino)-2-bicyclo[2.2.1]heptanyl]-4-methylpyridin-2-one.
| Compound Name | 1-hydroxy-6-[(1R,2S,4S)-3-(2-hydroxyethylamino)-2-bicyclo[2.2.1]heptanyl]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 139554316 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-hydroxy-6-[(1R,2S,4S)-3-(2-hydroxyethylamino)-2-bicyclo[2.2.1]heptanyl]-4-methylpyridin-2-one |
| SMILES | Cc1cc([C@@H]2C(NCCO)[C@H]3CC[C@@H]2C3)n(O)c(=O)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-9-6-12(17(20)13(19)7-9)14-10-2-3-11(8-10)15(14)16-4-5-18/h6-7,10-11,14-16,18,20H,2-5,8H2,1H3/t10-,11+,14-,15?/m1/s1 |
| InChIKey | PJHFWAXTJKKBKU-JLPXBYMMSA-N |
| XLogP | 0.86 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|