About 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one
1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one (PubChem CID 139554620) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one.
Molecular Properties
| Compound Name | 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one |
| PubChem CID | 139554620 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one |
| SMILES | Cc1oc(C(C)C)c2c1CN(C)C2=O |
| InChI | InChI=1S/C11H15NO2/c1-6(2)10-9-8(7(3)14-10)5-12(4)11(9)13/h6H,5H2,1-4H3 |
| InChIKey | IEXZKSIVNVHZHQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one?
The IUPAC name of 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one (CID 139554620) is 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one.
What is the SMILES notation for 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one?
The canonical SMILES for 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one is Cc1oc(C(C)C)c2c1CN(C)C2=O.
What is the InChIKey of 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one?
The InChIKey is IEXZKSIVNVHZHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-6(2)10-9-8(7(3)14-10)5-12(4)11(9)13/h6H,5H2,1-4H3.
What are the key properties of 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one?
1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one has a molecular weight of 193.25 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-3-propan-2-yl-6H-furo[3,4-c]pyrrol-4-one is sourced from PubChem (CID 139554620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).