C22H17F8N6O6P — CID 139554758
[1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-yl]oxymethyl dihydrogen phosphate (PubChem CID 139554758) has the molecular formula C22H17F8N6O6P and a molecular weight of 644.37 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-yl]oxymethyl dihydrogen phosphate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-yl]oxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 139554758 |
| Molecular Formula | C22H17F8N6O6P |
| Molecular Weight | 644.37 g/mol |
| Exact Mass | 644.08 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[[[5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]propan-2-yl]oxymethyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCOC(CNc1nc(-c2cc(-c3ccon3)n(Cc3ccccc3F)n2)ncc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H17F8N6O6P/c23-13-4-2-1-3-12(13)9-36-17(15-5-6-41-35-15)7-16(34-36)19-31-8-14(24)18(33-19)32-10-20(21(25,26)27,22(28,29)30)40-11-42-43(37,38)39/h1-8H,9-11H2,(H,31,32,33)(H2,37,38,39) |
| InChIKey | MRUSWBAJUZHXEF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 157.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|